C10H16O3 — CID 11298347
(4S)-4-[(1E)-2-methoxybuta-1,3-dienyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 11298347) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (4S)-4-[(1E)-2-methoxybuta-1,3-dienyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S)-4-[(1E)-2-methoxybuta-1,3-dienyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11298347 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (4S)-4-[(1E)-2-methoxybuta-1,3-dienyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=C/C(=C\[C@H]1COC(C)(C)O1)OC |
| InChI | InChI=1S/C10H16O3/c1-5-8(11-4)6-9-7-12-10(2,3)13-9/h5-6,9H,1,7H2,2-4H3/b8-6+/t9-/m0/s1 |
| InChIKey | YCVGBQWEKAMOKC-ORZBULNSSA-N |
| XLogP | 1.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|