methyl 5-(1,3-dioxolan-2-yl)pentanoate

C9H16O4 — CID 11298406

IUPACmethyl 5-(1,3-dioxolan-2-yl)pentanoate
SMILESCOC(=O)CCCCC1OCCO1
InChIInChI=1S/C9H16O4/c1-11-8(10)4-2-3-5-9-12-6-7-13-9/h9H,2-7H2,1H3
InChIKeyXDQVHLIZESHFTK-UHFFFAOYSA-N
MW188.22 g/mol
LogP1.09
Rot. Bonds5

About methyl 5-(1,3-dioxolan-2-yl)pentanoate

methyl 5-(1,3-dioxolan-2-yl)pentanoate (PubChem CID 11298406) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is methyl 5-(1,3-dioxolan-2-yl)pentanoate.

Molecular Properties

Compound Namemethyl 5-(1,3-dioxolan-2-yl)pentanoate
PubChem CID11298406
Molecular FormulaC9H16O4
Molecular Weight188.22 g/mol
Exact Mass188.10
IUPAC Namemethyl 5-(1,3-dioxolan-2-yl)pentanoate
SMILESCOC(=O)CCCCC1OCCO1
InChIInChI=1S/C9H16O4/c1-11-8(10)4-2-3-5-9-12-6-7-13-9/h9H,2-7H2,1H3
InChIKeyXDQVHLIZESHFTK-UHFFFAOYSA-N
XLogP1.09
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.22
LogP ≤ 51.09
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 5-(1,3-dioxolan-2-yl)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(1,3-dioxolan-2-yl)pentanoate?
The IUPAC name of methyl 5-(1,3-dioxolan-2-yl)pentanoate (CID 11298406) is methyl 5-(1,3-dioxolan-2-yl)pentanoate.
What is the SMILES notation for methyl 5-(1,3-dioxolan-2-yl)pentanoate?
The canonical SMILES for methyl 5-(1,3-dioxolan-2-yl)pentanoate is COC(=O)CCCCC1OCCO1.
What is the InChIKey of methyl 5-(1,3-dioxolan-2-yl)pentanoate?
The InChIKey is XDQVHLIZESHFTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c1-11-8(10)4-2-3-5-9-12-6-7-13-9/h9H,2-7H2,1H3.
What are the key properties of methyl 5-(1,3-dioxolan-2-yl)pentanoate?
methyl 5-(1,3-dioxolan-2-yl)pentanoate has a molecular weight of 188.22 g/mol, XLogP of 1.09, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(1,3-dioxolan-2-yl)pentanoate is sourced from PubChem (CID 11298406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).