About (2E)-3,7-dimethylocta-2,6-dien-1-amine;hydrochloride
(2E)-3,7-dimethylocta-2,6-dien-1-amine;hydrochloride (PubChem CID 11298432) has the molecular formula C10H20ClN
and a molecular weight of 189.73 g/mol. Its IUPAC name is (2E)-3,7-dimethylocta-2,6-dien-1-amine;hydrochloride.
Molecular Properties
| Compound Name | (2E)-3,7-dimethylocta-2,6-dien-1-amine;hydrochloride |
| PubChem CID | 11298432 |
| Molecular Formula | C10H20ClN |
| Molecular Weight | 189.73 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | (2E)-3,7-dimethylocta-2,6-dien-1-amine;hydrochloride |
| SMILES | CC(C)=CCC/C(C)=C/CN.Cl |
| InChI | InChI=1S/C10H19N.ClH/c1-9(2)5-4-6-10(3)7-8-11;/h5,7H,4,6,8,11H2,1-3H3;1H/b10-7+; |
| InChIKey | YXFOAGWDCVUEKH-HCUGZAAXSA-N |
| XLogP | 3.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.73 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-3,7-dimethylocta-2,6-dien-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-3,7-dimethylocta-2,6-dien-1-amine;hydrochloride?
The IUPAC name of (2E)-3,7-dimethylocta-2,6-dien-1-amine;hydrochloride (CID 11298432) is (2E)-3,7-dimethylocta-2,6-dien-1-amine;hydrochloride.
What is the SMILES notation for (2E)-3,7-dimethylocta-2,6-dien-1-amine;hydrochloride?
The canonical SMILES for (2E)-3,7-dimethylocta-2,6-dien-1-amine;hydrochloride is CC(C)=CCC/C(C)=C/CN.Cl.
What is the InChIKey of (2E)-3,7-dimethylocta-2,6-dien-1-amine;hydrochloride?
The InChIKey is YXFOAGWDCVUEKH-HCUGZAAXSA-N. The full InChI is InChI=1S/C10H19N.ClH/c1-9(2)5-4-6-10(3)7-8-11;/h5,7H,4,6,8,11H2,1-3H3;1H/b10-7+;.
What are the key properties of (2E)-3,7-dimethylocta-2,6-dien-1-amine;hydrochloride?
(2E)-3,7-dimethylocta-2,6-dien-1-amine;hydrochloride has a molecular weight of 189.73 g/mol, XLogP of 3.06, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-3,7-dimethylocta-2,6-dien-1-amine;hydrochloride is sourced from PubChem (CID 11298432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).