C10H14N2O2 — CID 11298492
2-hydroxy-N',N'-dimethyl-2-phenylacetohydrazide (PubChem CID 11298492) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-hydroxy-N',N'-dimethyl-2-phenylacetohydrazide.
| Compound Name | 2-hydroxy-N',N'-dimethyl-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 11298492 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-hydroxy-N',N'-dimethyl-2-phenylacetohydrazide |
| SMILES | CN(C)NC(=O)C(O)c1ccccc1 |
| InChI | InChI=1S/C10H14N2O2/c1-12(2)11-10(14)9(13)8-6-4-3-5-7-8/h3-7,9,13H,1-2H3,(H,11,14) |
| InChIKey | QMFXMZCUIINVOO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|