About 3,4-dibutylthiophene
3,4-dibutylthiophene (PubChem CID 11298534) has the molecular formula C12H20S
and a molecular weight of 196.36 g/mol. Its IUPAC name is 3,4-dibutylthiophene.
Molecular Properties
| Compound Name | 3,4-dibutylthiophene |
| PubChem CID | 11298534 |
| Molecular Formula | C12H20S |
| Molecular Weight | 196.36 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 3,4-dibutylthiophene |
| SMILES | CCCCc1cscc1CCCC |
| InChI | InChI=1S/C12H20S/c1-3-5-7-11-9-13-10-12(11)8-6-4-2/h9-10H,3-8H2,1-2H3 |
| InChIKey | FKXCQUBXKMXXBG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dibutylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibutylthiophene?
The IUPAC name of 3,4-dibutylthiophene (CID 11298534) is 3,4-dibutylthiophene.
What is the SMILES notation for 3,4-dibutylthiophene?
The canonical SMILES for 3,4-dibutylthiophene is CCCCc1cscc1CCCC.
What is the InChIKey of 3,4-dibutylthiophene?
The InChIKey is FKXCQUBXKMXXBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20S/c1-3-5-7-11-9-13-10-12(11)8-6-4-2/h9-10H,3-8H2,1-2H3.
What are the key properties of 3,4-dibutylthiophene?
3,4-dibutylthiophene has a molecular weight of 196.36 g/mol, XLogP of 4.43, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibutylthiophene is sourced from PubChem (CID 11298534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).