C11H20O3 — CID 11298584
(1S)-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]butan-1-ol (PubChem CID 11298584) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is (1S)-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]butan-1-ol.
| Compound Name | (1S)-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]butan-1-ol |
|---|---|
| PubChem CID | 11298584 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (1S)-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]butan-1-ol |
| SMILES | C=C[C@H]1OC(C)(C)O[C@H]1[C@@H](O)CCC |
| InChI | InChI=1S/C11H20O3/c1-5-7-8(12)10-9(6-2)13-11(3,4)14-10/h6,8-10,12H,2,5,7H2,1,3-4H3/t8-,9+,10-/m0/s1 |
| InChIKey | LOKYFUXHMHMKLW-AEJSXWLSSA-N |
| XLogP | 1.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|