C19H22N2O2 — CID 112986386
N-[4-(3,5-dimethylanilino)phenyl]oxolane-2-carboxamide (PubChem CID 112986386) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[4-(3,5-dimethylanilino)phenyl]oxolane-2-carboxamide.
| Compound Name | N-[4-(3,5-dimethylanilino)phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 112986386 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-[4-(3,5-dimethylanilino)phenyl]oxolane-2-carboxamide |
| SMILES | Cc1cc(C)cc(Nc2ccc(NC(=O)C3CCCO3)cc2)c1 |
| InChI | InChI=1S/C19H22N2O2/c1-13-10-14(2)12-17(11-13)20-15-5-7-16(8-6-15)21-19(22)18-4-3-9-23-18/h5-8,10-12,18,20H,3-4,9H2,1-2H3,(H,21,22) |
| InChIKey | HWDAZBDFLDIOPR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |