C18H23N3O — CID 112986426
1-[4-(2,6-dimethylanilino)phenyl]-3-propan-2-ylurea (PubChem CID 112986426) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-[4-(2,6-dimethylanilino)phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-(2,6-dimethylanilino)phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 112986426 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 1-[4-(2,6-dimethylanilino)phenyl]-3-propan-2-ylurea |
| SMILES | Cc1cccc(C)c1Nc1ccc(NC(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C18H23N3O/c1-12(2)19-18(22)21-16-10-8-15(9-11-16)20-17-13(3)6-5-7-14(17)4/h5-12,20H,1-4H3,(H2,19,21,22) |
| InChIKey | PUULMMBYKULEEU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |