C19H22N2O — CID 112986454
N-[4-(2,3-dimethylanilino)phenyl]cyclobutanecarboxamide (PubChem CID 112986454) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is N-[4-(2,3-dimethylanilino)phenyl]cyclobutanecarboxamide.
| Compound Name | N-[4-(2,3-dimethylanilino)phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 112986454 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-[4-(2,3-dimethylanilino)phenyl]cyclobutanecarboxamide |
| SMILES | Cc1cccc(Nc2ccc(NC(=O)C3CCC3)cc2)c1C |
| InChI | InChI=1S/C19H22N2O/c1-13-5-3-8-18(14(13)2)20-16-9-11-17(12-10-16)21-19(22)15-6-4-7-15/h3,5,8-12,15,20H,4,6-7H2,1-2H3,(H,21,22) |
| InChIKey | CTVMOHZGSCQKMX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |