C7H4F4N2O — CID 11298724
N-(2,3,5,6-tetrafluoro-4-pyridinyl)acetamide (PubChem CID 11298724) has the molecular formula C7H4F4N2O and a molecular weight of 208.11 g/mol. Its IUPAC name is N-(2,3,5,6-tetrafluoro-4-pyridinyl)acetamide.
| Compound Name | N-(2,3,5,6-tetrafluoro-4-pyridinyl)acetamide |
|---|---|
| PubChem CID | 11298724 |
| Molecular Formula | C7H4F4N2O |
| Molecular Weight | 208.11 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | N-(2,3,5,6-tetrafluoro-4-pyridinyl)acetamide |
| SMILES | CC(=O)Nc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C7H4F4N2O/c1-2(14)12-5-3(8)6(10)13-7(11)4(5)9/h1H3,(H,12,13,14) |
| InChIKey | LVGBFUCHHGWFOC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.11 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|