C11H12O4 — CID 11298725
ethyl 2-(prop-2-ynoxymethyl)furan-3-carboxylate (PubChem CID 11298725) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is ethyl 2-(prop-2-ynoxymethyl)furan-3-carboxylate.
| Compound Name | ethyl 2-(prop-2-ynoxymethyl)furan-3-carboxylate |
|---|---|
| PubChem CID | 11298725 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | ethyl 2-(prop-2-ynoxymethyl)furan-3-carboxylate |
| SMILES | C#CCOCc1occc1C(=O)OCC |
| InChI | InChI=1S/C11H12O4/c1-3-6-13-8-10-9(5-7-15-10)11(12)14-4-2/h1,5,7H,4,6,8H2,2H3 |
| InChIKey | FQJPJZOAFFILDV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|