3-methoxythiophene-2-sulfonyl chloride

C5H5ClO3S2 — CID 11298822

IUPAC3-methoxythiophene-2-sulfonyl chloride
SMILESCOc1ccsc1S(=O)(=O)Cl
InChIInChI=1S/C5H5ClO3S2/c1-9-4-2-3-10-5(4)11(6,7)8/h2-3H,1H3
InChIKeyHLKHDXRCRNEXSF-UHFFFAOYSA-N
MW212.68 g/mol
LogP1.68
Rot. Bonds2

About 3-methoxythiophene-2-sulfonyl chloride

3-methoxythiophene-2-sulfonyl chloride (PubChem CID 11298822) has the molecular formula C5H5ClO3S2 and a molecular weight of 212.68 g/mol. Its IUPAC name is 3-methoxythiophene-2-sulfonyl chloride.

Molecular Properties

Compound Name3-methoxythiophene-2-sulfonyl chloride
PubChem CID11298822
Molecular FormulaC5H5ClO3S2
Molecular Weight212.68 g/mol
Exact Mass211.94
IUPAC Name3-methoxythiophene-2-sulfonyl chloride
SMILESCOc1ccsc1S(=O)(=O)Cl
InChIInChI=1S/C5H5ClO3S2/c1-9-4-2-3-10-5(4)11(6,7)8/h2-3H,1H3
InChIKeyHLKHDXRCRNEXSF-UHFFFAOYSA-N
XLogP1.68
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.68
LogP ≤ 51.68
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 3-methoxythiophene-2-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methoxythiophene-2-sulfonyl chloride?
The IUPAC name of 3-methoxythiophene-2-sulfonyl chloride (CID 11298822) is 3-methoxythiophene-2-sulfonyl chloride.
What is the SMILES notation for 3-methoxythiophene-2-sulfonyl chloride?
The canonical SMILES for 3-methoxythiophene-2-sulfonyl chloride is COc1ccsc1S(=O)(=O)Cl.
What is the InChIKey of 3-methoxythiophene-2-sulfonyl chloride?
The InChIKey is HLKHDXRCRNEXSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClO3S2/c1-9-4-2-3-10-5(4)11(6,7)8/h2-3H,1H3.
What are the key properties of 3-methoxythiophene-2-sulfonyl chloride?
3-methoxythiophene-2-sulfonyl chloride has a molecular weight of 212.68 g/mol, XLogP of 1.68, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxythiophene-2-sulfonyl chloride is sourced from PubChem (CID 11298822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).