C11H20O4 — CID 11298887
(1S)-1-[(2R,3aR,5S,6aS)-2-(2-hydroxyethyl)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl]propan-1-ol (PubChem CID 11298887) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is (1S)-1-[(2R,3aR,5S,6aS)-2-(2-hydroxyethyl)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl]propan-1-ol.
| Compound Name | (1S)-1-[(2R,3aR,5S,6aS)-2-(2-hydroxyethyl)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl]propan-1-ol |
|---|---|
| PubChem CID | 11298887 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | (1S)-1-[(2R,3aR,5S,6aS)-2-(2-hydroxyethyl)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-5-yl]propan-1-ol |
| SMILES | CC[C@H](O)[C@@H]1C[C@H]2C[C@H](CCO)O[C@H]2O1 |
| InChI | InChI=1S/C11H20O4/c1-2-9(13)10-6-7-5-8(3-4-12)14-11(7)15-10/h7-13H,2-6H2,1H3/t7-,8+,9+,10+,11+/m1/s1 |
| InChIKey | PYTGTFSBNRHFEC-NMUGVGKYSA-N |
| XLogP | 0.66 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |