C20H16F2N2O — CID 112990214
N-[4-(2,6-difluoroanilino)phenyl]-2-phenylacetamide (PubChem CID 112990214) has the molecular formula C20H16F2N2O and a molecular weight of 338.36 g/mol. Its IUPAC name is N-[4-(2,6-difluoroanilino)phenyl]-2-phenylacetamide.
| Compound Name | N-[4-(2,6-difluoroanilino)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 112990214 |
| Molecular Formula | C20H16F2N2O |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-[4-(2,6-difluoroanilino)phenyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(Nc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C20H16F2N2O/c21-17-7-4-8-18(22)20(17)24-16-11-9-15(10-12-16)23-19(25)13-14-5-2-1-3-6-14/h1-12,24H,13H2,(H,23,25) |
| InChIKey | VXOAKZPWDKNNSA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |