C20H18N4O2 — CID 112990361
2-(1H-indol-3-yl)-N-[4-[(5-methyl-1,2-oxazol-3-yl)amino]phenyl]acetamide (PubChem CID 112990361) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-[4-[(5-methyl-1,2-oxazol-3-yl)amino]phenyl]acetamide.
| Compound Name | 2-(1H-indol-3-yl)-N-[4-[(5-methyl-1,2-oxazol-3-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112990361 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-[4-[(5-methyl-1,2-oxazol-3-yl)amino]phenyl]acetamide |
| SMILES | Cc1cc(Nc2ccc(NC(=O)Cc3c[nH]c4ccccc34)cc2)no1 |
| InChI | InChI=1S/C20H18N4O2/c1-13-10-19(24-26-13)22-15-6-8-16(9-7-15)23-20(25)11-14-12-21-18-5-3-2-4-17(14)18/h2-10,12,21H,11H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | XIZKKGBLWVRXLE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |