C14H17BrN2O2 — CID 112990865
2-(2-bromophenyl)-N-(2-oxo-2-pyrrolidin-1-ylethyl)acetamide (PubChem CID 112990865) has the molecular formula C14H17BrN2O2 and a molecular weight of 325.21 g/mol. Its IUPAC name is 2-(2-bromophenyl)-N-(2-oxo-2-pyrrolidin-1-ylethyl)acetamide.
| Compound Name | 2-(2-bromophenyl)-N-(2-oxo-2-pyrrolidin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 112990865 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-(2-bromophenyl)-N-(2-oxo-2-pyrrolidin-1-ylethyl)acetamide |
| SMILES | O=C(Cc1ccccc1Br)NCC(=O)N1CCCC1 |
| InChI | InChI=1S/C14H17BrN2O2/c15-12-6-2-1-5-11(12)9-13(18)16-10-14(19)17-7-3-4-8-17/h1-2,5-6H,3-4,7-10H2,(H,16,18) |
| InChIKey | HMJGMGWTRHCQPZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |