C16H22N2O3 — CID 112991346
2-(4-methylphenyl)-N-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]acetamide (PubChem CID 112991346) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-(4-methylphenyl)-N-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]acetamide.
| Compound Name | 2-(4-methylphenyl)-N-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 112991346 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-(4-methylphenyl)-N-[2-oxo-2-(oxolan-2-ylmethylamino)ethyl]acetamide |
| SMILES | Cc1ccc(CC(=O)NCC(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C16H22N2O3/c1-12-4-6-13(7-5-12)9-15(19)18-11-16(20)17-10-14-3-2-8-21-14/h4-7,14H,2-3,8-11H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | VSNRNJFDLZBJOD-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |