About 1-isocyano-1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexane
1-isocyano-1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexane (PubChem CID 11299212) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is 1-isocyano-1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexane.
Molecular Properties
| Compound Name | 1-isocyano-1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexane |
| PubChem CID | 11299212 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 1-isocyano-1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexane |
| SMILES | [C-]#[N+]C1(C)CCC(C(=C)CCC=C(C)C)CC1 |
| InChI | InChI=1S/C16H25N/c1-13(2)7-6-8-14(3)15-9-11-16(4,17-5)12-10-15/h7,15H,3,6,8-12H2,1-2,4H3 |
| InChIKey | AUJRLJBMOPBACN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyano-1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyano-1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexane?
The IUPAC name of 1-isocyano-1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexane (CID 11299212) is 1-isocyano-1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexane.
What is the SMILES notation for 1-isocyano-1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexane?
The canonical SMILES for 1-isocyano-1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexane is [C-]#[N+]C1(C)CCC(C(=C)CCC=C(C)C)CC1.
What is the InChIKey of 1-isocyano-1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexane?
The InChIKey is AUJRLJBMOPBACN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N/c1-13(2)7-6-8-14(3)15-9-11-16(4,17-5)12-10-15/h7,15H,3,6,8-12H2,1-2,4H3.
What are the key properties of 1-isocyano-1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexane?
1-isocyano-1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexane has a molecular weight of 231.38 g/mol, XLogP of 5.16, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyano-1-methyl-4-(6-methylhepta-1,5-dien-2-yl)cyclohexane is sourced from PubChem (CID 11299212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).