C18H19FN2O2 — CID 112992570
N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-2-(3-methylphenyl)acetamide (PubChem CID 112992570) has the molecular formula C18H19FN2O2 and a molecular weight of 314.36 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-2-(3-methylphenyl)acetamide.
| Compound Name | N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-2-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 112992570 |
| Molecular Formula | C18H19FN2O2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl]-2-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(CC(=O)NCC(=O)NCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H19FN2O2/c1-13-3-2-4-15(9-13)10-17(22)21-12-18(23)20-11-14-5-7-16(19)8-6-14/h2-9H,10-12H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | KWRVRLLODVEXDM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |