C19H23N3O3 — CID 112993704
N-[2-[methyl(2-pyridin-4-ylethyl)amino]-2-oxoethyl]-3-phenoxypropanamide (PubChem CID 112993704) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[2-[methyl(2-pyridin-4-ylethyl)amino]-2-oxoethyl]-3-phenoxypropanamide.
| Compound Name | N-[2-[methyl(2-pyridin-4-ylethyl)amino]-2-oxoethyl]-3-phenoxypropanamide |
|---|---|
| PubChem CID | 112993704 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-[2-[methyl(2-pyridin-4-ylethyl)amino]-2-oxoethyl]-3-phenoxypropanamide |
| SMILES | CN(CCc1ccncc1)C(=O)CNC(=O)CCOc1ccccc1 |
| InChI | InChI=1S/C19H23N3O3/c1-22(13-9-16-7-11-20-12-8-16)19(24)15-21-18(23)10-14-25-17-5-3-2-4-6-17/h2-8,11-12H,9-10,13-15H2,1H3,(H,21,23) |
| InChIKey | DVJTVSSACCSLOY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |