C14H22O3 — CID 11299398
ethyl (E)-4-oxo-4-[(1R)-1,2,2-trimethylcyclopentyl]but-2-enoate (PubChem CID 11299398) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is ethyl (E)-4-oxo-4-[(1R)-1,2,2-trimethylcyclopentyl]but-2-enoate.
| Compound Name | ethyl (E)-4-oxo-4-[(1R)-1,2,2-trimethylcyclopentyl]but-2-enoate |
|---|---|
| PubChem CID | 11299398 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | ethyl (E)-4-oxo-4-[(1R)-1,2,2-trimethylcyclopentyl]but-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)[C@]1(C)CCCC1(C)C |
| InChI | InChI=1S/C14H22O3/c1-5-17-12(16)8-7-11(15)14(4)10-6-9-13(14,2)3/h7-8H,5-6,9-10H2,1-4H3/b8-7+/t14-/m0/s1 |
| InChIKey | YDFQTOCDLFVOIV-NPQIQWPPSA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|