C16H24N2O3S — CID 112995596
N-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]-3-methylbenzenesulfonamide (PubChem CID 112995596) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is N-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]-3-methylbenzenesulfonamide.
| Compound Name | N-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 112995596 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[2-(2-ethylpiperidin-1-yl)-2-oxoethyl]-3-methylbenzenesulfonamide |
| SMILES | CCC1CCCCN1C(=O)CNS(=O)(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C16H24N2O3S/c1-3-14-8-4-5-10-18(14)16(19)12-17-22(20,21)15-9-6-7-13(2)11-15/h6-7,9,11,14,17H,3-5,8,10,12H2,1-2H3 |
| InChIKey | RGXQFSWLSWBGMY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |