C15H23NO2 — CID 11299669
(2E,4E)-1-piperidin-1-yldeca-2,4-diene-1,6-dione (PubChem CID 11299669) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (2E,4E)-1-piperidin-1-yldeca-2,4-diene-1,6-dione.
| Compound Name | (2E,4E)-1-piperidin-1-yldeca-2,4-diene-1,6-dione |
|---|---|
| PubChem CID | 11299669 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (2E,4E)-1-piperidin-1-yldeca-2,4-diene-1,6-dione |
| SMILES | CCCCC(=O)/C=C/C=C/C(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H23NO2/c1-2-3-9-14(17)10-5-6-11-15(18)16-12-7-4-8-13-16/h5-6,10-11H,2-4,7-9,12-13H2,1H3/b10-5+,11-6+ |
| InChIKey | WSNYQSDXCCPJJP-YOYBCKCWSA-N |
| XLogP | 2.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|