C11H10N2O3S — CID 11299688
1-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)butane-1,3-dione (PubChem CID 11299688) has the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. Its IUPAC name is 1-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)butane-1,3-dione.
| Compound Name | 1-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 11299688 |
| Molecular Formula | C11H10N2O3S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 1-(7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-6-yl)butane-1,3-dione |
| SMILES | CC(=O)CC(=O)c1c(C)nc2sccn2c1=O |
| InChI | InChI=1S/C11H10N2O3S/c1-6(14)5-8(15)9-7(2)12-11-13(10(9)16)3-4-17-11/h3-4H,5H2,1-2H3 |
| InChIKey | QSRMOQNMXWTZSY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 68.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|