C7H12N2O6S — CID 11299732
2-amino-2-[(4S)-4-methoxycarbonyl-4,5-dihydro-1,3-oxazol-2-yl]ethanesulfonic acid (PubChem CID 11299732) has the molecular formula C7H12N2O6S and a molecular weight of 252.25 g/mol. Its IUPAC name is 2-amino-2-[(4S)-4-methoxycarbonyl-4,5-dihydro-1,3-oxazol-2-yl]ethanesulfonic acid.
| Compound Name | 2-amino-2-[(4S)-4-methoxycarbonyl-4,5-dihydro-1,3-oxazol-2-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 11299732 |
| Molecular Formula | C7H12N2O6S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 2-amino-2-[(4S)-4-methoxycarbonyl-4,5-dihydro-1,3-oxazol-2-yl]ethanesulfonic acid |
| SMILES | COC(=O)[C@@H]1COC(C(N)CS(=O)(=O)O)=N1 |
| InChI | InChI=1S/C7H12N2O6S/c1-14-7(10)5-2-15-6(9-5)4(8)3-16(11,12)13/h4-5H,2-3,8H2,1H3,(H,11,12,13)/t4?,5-/m0/s1 |
| InChIKey | JEZYXSJZMAVFNH-AKGZTFGVSA-N |
| XLogP | -1.83 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|