C17H24N2O2 — CID 112997525
N-[2-(2-tert-butylanilino)-2-oxoethyl]cyclobutanecarboxamide (PubChem CID 112997525) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N-[2-(2-tert-butylanilino)-2-oxoethyl]cyclobutanecarboxamide.
| Compound Name | N-[2-(2-tert-butylanilino)-2-oxoethyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 112997525 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | N-[2-(2-tert-butylanilino)-2-oxoethyl]cyclobutanecarboxamide |
| SMILES | CC(C)(C)c1ccccc1NC(=O)CNC(=O)C1CCC1 |
| InChI | InChI=1S/C17H24N2O2/c1-17(2,3)13-9-4-5-10-14(13)19-15(20)11-18-16(21)12-7-6-8-12/h4-5,9-10,12H,6-8,11H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | OYJRHEOQSSNPHH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |