C16H14ClN3O4S — CID 112997954
N-(4-chlorophenyl)-2-[(2-oxo-1,3-dihydroindol-5-yl)sulfonylamino]acetamide (PubChem CID 112997954) has the molecular formula C16H14ClN3O4S and a molecular weight of 379.83 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(2-oxo-1,3-dihydroindol-5-yl)sulfonylamino]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(2-oxo-1,3-dihydroindol-5-yl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 112997954 |
| Molecular Formula | C16H14ClN3O4S |
| Molecular Weight | 379.83 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(2-oxo-1,3-dihydroindol-5-yl)sulfonylamino]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc2c(c1)CC(=O)N2)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClN3O4S/c17-11-1-3-12(4-2-11)19-16(22)9-18-25(23,24)13-5-6-14-10(7-13)8-15(21)20-14/h1-7,18H,8-9H2,(H,19,22)(H,20,21) |
| InChIKey | IJOZPBBGSJXCJU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.83 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |