C18H22N2O4S — CID 112998959
N-(2-methoxy-5-methylphenyl)-2-(2-phenylethylsulfonylamino)acetamide (PubChem CID 112998959) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is N-(2-methoxy-5-methylphenyl)-2-(2-phenylethylsulfonylamino)acetamide.
| Compound Name | N-(2-methoxy-5-methylphenyl)-2-(2-phenylethylsulfonylamino)acetamide |
|---|---|
| PubChem CID | 112998959 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-(2-methoxy-5-methylphenyl)-2-(2-phenylethylsulfonylamino)acetamide |
| SMILES | COc1ccc(C)cc1NC(=O)CNS(=O)(=O)CCc1ccccc1 |
| InChI | InChI=1S/C18H22N2O4S/c1-14-8-9-17(24-2)16(12-14)20-18(21)13-19-25(22,23)11-10-15-6-4-3-5-7-15/h3-9,12,19H,10-11,13H2,1-2H3,(H,20,21) |
| InChIKey | MKNKXEUULSCLIX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |