About 2,3-dibromo-N,N-dimethylpropanamide
2,3-dibromo-N,N-dimethylpropanamide (PubChem CID 11299911) has the molecular formula C5H9Br2NO
and a molecular weight of 258.94 g/mol. Its IUPAC name is 2,3-dibromo-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 2,3-dibromo-N,N-dimethylpropanamide |
| PubChem CID | 11299911 |
| Molecular Formula | C5H9Br2NO |
| Molecular Weight | 258.94 g/mol |
| Exact Mass | 256.91 |
| IUPAC Name | 2,3-dibromo-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)C(Br)CBr |
| InChI | InChI=1S/C5H9Br2NO/c1-8(2)5(9)4(7)3-6/h4H,3H2,1-2H3 |
| InChIKey | NGLXUWPQWYFICX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.94 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dibromo-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromo-N,N-dimethylpropanamide?
The IUPAC name of 2,3-dibromo-N,N-dimethylpropanamide (CID 11299911) is 2,3-dibromo-N,N-dimethylpropanamide.
What is the SMILES notation for 2,3-dibromo-N,N-dimethylpropanamide?
The canonical SMILES for 2,3-dibromo-N,N-dimethylpropanamide is CN(C)C(=O)C(Br)CBr.
What is the InChIKey of 2,3-dibromo-N,N-dimethylpropanamide?
The InChIKey is NGLXUWPQWYFICX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9Br2NO/c1-8(2)5(9)4(7)3-6/h4H,3H2,1-2H3.
What are the key properties of 2,3-dibromo-N,N-dimethylpropanamide?
2,3-dibromo-N,N-dimethylpropanamide has a molecular weight of 258.94 g/mol, XLogP of 1.23, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromo-N,N-dimethylpropanamide is sourced from PubChem (CID 11299911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).