C14H22N2O5S — CID 112999249
2-(butylsulfonylamino)-N-(2,4-dimethoxyphenyl)acetamide (PubChem CID 112999249) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-(butylsulfonylamino)-N-(2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-(butylsulfonylamino)-N-(2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 112999249 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-(butylsulfonylamino)-N-(2,4-dimethoxyphenyl)acetamide |
| SMILES | CCCCS(=O)(=O)NCC(=O)Nc1ccc(OC)cc1OC |
| InChI | InChI=1S/C14H22N2O5S/c1-4-5-8-22(18,19)15-10-14(17)16-12-7-6-11(20-2)9-13(12)21-3/h6-7,9,15H,4-5,8,10H2,1-3H3,(H,16,17) |
| InChIKey | KJRYKHBTWVGRHR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |