C17H18N2O7S — CID 112999264
2-(1,3-benzodioxol-5-ylsulfonylamino)-N-(2,4-dimethoxyphenyl)acetamide (PubChem CID 112999264) has the molecular formula C17H18N2O7S and a molecular weight of 394.41 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylsulfonylamino)-N-(2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylsulfonylamino)-N-(2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 112999264 |
| Molecular Formula | C17H18N2O7S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylsulfonylamino)-N-(2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CNS(=O)(=O)c2ccc3c(c2)OCO3)c(OC)c1 |
| InChI | InChI=1S/C17H18N2O7S/c1-23-11-3-5-13(15(7-11)24-2)19-17(20)9-18-27(21,22)12-4-6-14-16(8-12)26-10-25-14/h3-8,18H,9-10H2,1-2H3,(H,19,20) |
| InChIKey | OYZDWJNYBBUCGB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |