C15H18O4 — CID 11299991
(1R,3R,5S,11S,14R)-14-hydroxy-3,8,12-trimethyl-2,6-dioxatetracyclo[9.3.0.01,3.05,9]tetradeca-8,12-dien-7-one (PubChem CID 11299991) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is (1R,3R,5S,11S,14R)-14-hydroxy-3,8,12-trimethyl-2,6-dioxatetracyclo[9.3.0.01,3.05,9]tetradeca-8,12-dien-7-one.
| Compound Name | (1R,3R,5S,11S,14R)-14-hydroxy-3,8,12-trimethyl-2,6-dioxatetracyclo[9.3.0.01,3.05,9]tetradeca-8,12-dien-7-one |
|---|---|
| PubChem CID | 11299991 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (1R,3R,5S,11S,14R)-14-hydroxy-3,8,12-trimethyl-2,6-dioxatetracyclo[9.3.0.01,3.05,9]tetradeca-8,12-dien-7-one |
| SMILES | CC1=C[C@@H](O)[C@@]23O[C@]2(C)C[C@@H]2OC(=O)C(C)=C2C[C@@H]13 |
| InChI | InChI=1S/C15H18O4/c1-7-4-12(16)15-10(7)5-9-8(2)13(17)18-11(9)6-14(15,3)19-15/h4,10-12,16H,5-6H2,1-3H3/t10-,11-,12+,14+,15+/m0/s1 |
| InChIKey | QKIQAUSGMKJYFS-CWFCOSEVSA-N |
| XLogP | 1.49 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|