C17H16N2O — CID 11300052
1-Isoquinolinamine, N-(4-methoxyphenyl)-N-methyl- (PubChem CID 11300052) has the molecular formula C17H16N2O and a molecular weight of 264.32 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-N-methylisoquinolin-1-amine.
| Compound Name | 1-Isoquinolinamine, N-(4-methoxyphenyl)-N-methyl- |
|---|---|
| PubChem CID | 11300052 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | N-(4-methoxyphenyl)-N-methylisoquinolin-1-amine |
| SMILES | CN(C1=CC=C(C=C1)OC)C2=NC=CC3=CC=CC=C32 |
| InChI | InChI=1S/C17H16N2O/c1-19(14-7-9-15(20-2)10-8-14)17-16-6-4-3-5-13(16)11-12-18-17/h3-12H,1-2H3 |
| InChIKey | XKYHYVYGGIKRPR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 25.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | 301 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |