C16H13BrF2N2O2 — CID 113000855
2-(2-bromophenyl)-N-[2-(2,4-difluoroanilino)-2-oxoethyl]acetamide (PubChem CID 113000855) has the molecular formula C16H13BrF2N2O2 and a molecular weight of 383.19 g/mol. Its IUPAC name is 2-(2-bromophenyl)-N-[2-(2,4-difluoroanilino)-2-oxoethyl]acetamide.
| Compound Name | 2-(2-bromophenyl)-N-[2-(2,4-difluoroanilino)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 113000855 |
| Molecular Formula | C16H13BrF2N2O2 |
| Molecular Weight | 383.19 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | 2-(2-bromophenyl)-N-[2-(2,4-difluoroanilino)-2-oxoethyl]acetamide |
| SMILES | O=C(Cc1ccccc1Br)NCC(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C16H13BrF2N2O2/c17-12-4-2-1-3-10(12)7-15(22)20-9-16(23)21-14-6-5-11(18)8-13(14)19/h1-6,8H,7,9H2,(H,20,22)(H,21,23) |
| InChIKey | DCKRBNBBBVMVFM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |