About 1-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]naphthalen-2-ol
1-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]naphthalen-2-ol (PubChem CID 1130023) has the molecular formula C23H18N2O2S
and a molecular weight of 386.48 g/mol. Its IUPAC name is 1-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]naphthalen-2-ol.
Molecular Properties
| Compound Name | 1-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]naphthalen-2-ol |
| PubChem CID | 1130023 |
| Molecular Formula | C23H18N2O2S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 1-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]naphthalen-2-ol |
| SMILES | COc1ccc2c(c1)-c1nc(N=Cc3c(O)ccc4ccccc34)sc1CC2 |
| InChI | InChI=1S/C23H18N2O2S/c1-27-16-9-6-15-8-11-21-22(18(15)12-16)25-23(28-21)24-13-19-17-5-3-2-4-14(17)7-10-20(19)26/h2-7,9-10,12-13,26H,8,11H2,1H3 |
| InChIKey | OMXLJPJHRBQBCC-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]naphthalen-2-ol?
The IUPAC name of 1-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]naphthalen-2-ol (CID 1130023) is 1-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]naphthalen-2-ol.
What is the SMILES notation for 1-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]naphthalen-2-ol?
The canonical SMILES for 1-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]naphthalen-2-ol is COc1ccc2c(c1)-c1nc(N=Cc3c(O)ccc4ccccc34)sc1CC2.
What is the InChIKey of 1-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]naphthalen-2-ol?
The InChIKey is OMXLJPJHRBQBCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N2O2S/c1-27-16-9-6-15-8-11-21-22(18(15)12-16)25-23(28-21)24-13-19-17-5-3-2-4-14(17)7-10-20(19)26/h2-7,9-10,12-13,26H,8,11H2,1H3.
What are the key properties of 1-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]naphthalen-2-ol?
1-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]naphthalen-2-ol has a molecular weight of 386.48 g/mol, XLogP of 5.53, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]naphthalen-2-ol is sourced from PubChem (CID 1130023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).