C11H15BrO3 — CID 11300321
methyl (2E,5R,6E,8E)-9-bromo-5-hydroxy-3-methylnona-2,6,8-trienoate (PubChem CID 11300321) has the molecular formula C11H15BrO3 and a molecular weight of 275.14 g/mol. Its IUPAC name is methyl (2E,5R,6E,8E)-9-bromo-5-hydroxy-3-methylnona-2,6,8-trienoate.
| Compound Name | methyl (2E,5R,6E,8E)-9-bromo-5-hydroxy-3-methylnona-2,6,8-trienoate |
|---|---|
| PubChem CID | 11300321 |
| Molecular Formula | C11H15BrO3 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | methyl (2E,5R,6E,8E)-9-bromo-5-hydroxy-3-methylnona-2,6,8-trienoate |
| SMILES | COC(=O)/C=C(\C)C[C@@H](O)/C=C/C=C/Br |
| InChI | InChI=1S/C11H15BrO3/c1-9(8-11(14)15-2)7-10(13)5-3-4-6-12/h3-6,8,10,13H,7H2,1-2H3/b5-3+,6-4+,9-8+/t10-/m0/s1 |
| InChIKey | WGWYKQWVFJDGBR-IZQIJEHOSA-N |
| XLogP | 2.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|