C24H30N2O2 — CID 113004413
N-benzyl-N-ethyl-1-[2-(3-methylphenyl)acetyl]piperidine-4-carboxamide (PubChem CID 113004413) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-benzyl-N-ethyl-1-[2-(3-methylphenyl)acetyl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-N-ethyl-1-[2-(3-methylphenyl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113004413 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | N-benzyl-N-ethyl-1-[2-(3-methylphenyl)acetyl]piperidine-4-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C1CCN(C(=O)Cc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C24H30N2O2/c1-3-25(18-20-9-5-4-6-10-20)24(28)22-12-14-26(15-13-22)23(27)17-21-11-7-8-19(2)16-21/h4-11,16,22H,3,12-15,17-18H2,1-2H3 |
| InChIKey | XDUUITXXGBTJOB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |