C17H24N2O5S — CID 113005310
1-(1,3-benzodioxol-5-ylsulfonyl)-N,N-diethylpiperidine-4-carboxamide (PubChem CID 113005310) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylsulfonyl)-N,N-diethylpiperidine-4-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-N,N-diethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 113005310 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-N,N-diethylpiperidine-4-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCN(S(=O)(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C17H24N2O5S/c1-3-18(4-2)17(20)13-7-9-19(10-8-13)25(21,22)14-5-6-15-16(11-14)24-12-23-15/h5-6,11,13H,3-4,7-10,12H2,1-2H3 |
| InChIKey | CRXPOGLRLWLYKI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |