C22H32N2O2 — CID 113005452
N-cycloheptyl-1-[2-(3-methylphenyl)acetyl]piperidine-4-carboxamide (PubChem CID 113005452) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is N-cycloheptyl-1-[2-(3-methylphenyl)acetyl]piperidine-4-carboxamide.
| Compound Name | N-cycloheptyl-1-[2-(3-methylphenyl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113005452 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | N-cycloheptyl-1-[2-(3-methylphenyl)acetyl]piperidine-4-carboxamide |
| SMILES | Cc1cccc(CC(=O)N2CCC(C(=O)NC3CCCCCC3)CC2)c1 |
| InChI | InChI=1S/C22H32N2O2/c1-17-7-6-8-18(15-17)16-21(25)24-13-11-19(12-14-24)22(26)23-20-9-4-2-3-5-10-20/h6-8,15,19-20H,2-5,9-14,16H2,1H3,(H,23,26) |
| InChIKey | UAATUJGDZAMVBI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |