C13H20O5Si — CID 11300603
2-trimethylsilylethyl (1S,6S)-1-hydroxy-6-methyl-2,5-dioxocyclohex-3-ene-1-carboxylate (PubChem CID 11300603) has the molecular formula C13H20O5Si and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-trimethylsilylethyl (1S,6S)-1-hydroxy-6-methyl-2,5-dioxocyclohex-3-ene-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl (1S,6S)-1-hydroxy-6-methyl-2,5-dioxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11300603 |
| Molecular Formula | C13H20O5Si |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-trimethylsilylethyl (1S,6S)-1-hydroxy-6-methyl-2,5-dioxocyclohex-3-ene-1-carboxylate |
| SMILES | C[C@@H]1C(=O)C=CC(=O)[C@]1(O)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C13H20O5Si/c1-9-10(14)5-6-11(15)13(9,17)12(16)18-7-8-19(2,3)4/h5-6,9,17H,7-8H2,1-4H3/t9-,13+/m1/s1 |
| InChIKey | LHJLEVGXFOKUPQ-RNCFNFMXSA-N |
| XLogP | 0.94 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|