C23H28N2O2 — CID 113006744
N-(2-ethyl-6-methylphenyl)-1-(2-phenylacetyl)piperidine-4-carboxamide (PubChem CID 113006744) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-(2-ethyl-6-methylphenyl)-1-(2-phenylacetyl)piperidine-4-carboxamide.
| Compound Name | N-(2-ethyl-6-methylphenyl)-1-(2-phenylacetyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 113006744 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | N-(2-ethyl-6-methylphenyl)-1-(2-phenylacetyl)piperidine-4-carboxamide |
| SMILES | CCc1cccc(C)c1NC(=O)C1CCN(C(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H28N2O2/c1-3-19-11-7-8-17(2)22(19)24-23(27)20-12-14-25(15-13-20)21(26)16-18-9-5-4-6-10-18/h4-11,20H,3,12-16H2,1-2H3,(H,24,27) |
| InChIKey | LHVSXDQYEKERQS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |