About 3-(2-methylpropoxy)-2,5-diphenylfuran
3-(2-methylpropoxy)-2,5-diphenylfuran (PubChem CID 11300822) has the molecular formula C20H20O2
and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-(2-methylpropoxy)-2,5-diphenylfuran.
Molecular Properties
| Compound Name | 3-(2-methylpropoxy)-2,5-diphenylfuran |
| PubChem CID | 11300822 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 3-(2-methylpropoxy)-2,5-diphenylfuran |
| SMILES | CC(C)COc1cc(-c2ccccc2)oc1-c1ccccc1 |
| InChI | InChI=1S/C20H20O2/c1-15(2)14-21-19-13-18(16-9-5-3-6-10-16)22-20(19)17-11-7-4-8-12-17/h3-13,15H,14H2,1-2H3 |
| InChIKey | GIDDZJWOMFSITR-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-methylpropoxy)-2,5-diphenylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylpropoxy)-2,5-diphenylfuran?
The IUPAC name of 3-(2-methylpropoxy)-2,5-diphenylfuran (CID 11300822) is 3-(2-methylpropoxy)-2,5-diphenylfuran.
What is the SMILES notation for 3-(2-methylpropoxy)-2,5-diphenylfuran?
The canonical SMILES for 3-(2-methylpropoxy)-2,5-diphenylfuran is CC(C)COc1cc(-c2ccccc2)oc1-c1ccccc1.
What is the InChIKey of 3-(2-methylpropoxy)-2,5-diphenylfuran?
The InChIKey is GIDDZJWOMFSITR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O2/c1-15(2)14-21-19-13-18(16-9-5-3-6-10-16)22-20(19)17-11-7-4-8-12-17/h3-13,15H,14H2,1-2H3.
What are the key properties of 3-(2-methylpropoxy)-2,5-diphenylfuran?
3-(2-methylpropoxy)-2,5-diphenylfuran has a molecular weight of 292.38 g/mol, XLogP of 5.65, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylpropoxy)-2,5-diphenylfuran is sourced from PubChem (CID 11300822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).