C17H21N3O2 — CID 113009463
N-[6-(butylamino)-3-pyridinyl]-3-methoxybenzamide (PubChem CID 113009463) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-[6-(butylamino)-3-pyridinyl]-3-methoxybenzamide.
| Compound Name | N-[6-(butylamino)-3-pyridinyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 113009463 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-[6-(butylamino)-3-pyridinyl]-3-methoxybenzamide |
| SMILES | CCCCNc1ccc(NC(=O)c2cccc(OC)c2)cn1 |
| InChI | InChI=1S/C17H21N3O2/c1-3-4-10-18-16-9-8-14(12-19-16)20-17(21)13-6-5-7-15(11-13)22-2/h5-9,11-12H,3-4,10H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | MHCZQZBROJIQTG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|