C16H20FN3O2S — CID 113009667
4-fluoro-2-methyl-N-[6-(2-methylpropylamino)-3-pyridinyl]benzenesulfonamide (PubChem CID 113009667) has the molecular formula C16H20FN3O2S and a molecular weight of 337.42 g/mol. Its IUPAC name is 4-fluoro-2-methyl-N-[6-(2-methylpropylamino)-3-pyridinyl]benzenesulfonamide.
| Compound Name | 4-fluoro-2-methyl-N-[6-(2-methylpropylamino)-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113009667 |
| Molecular Formula | C16H20FN3O2S |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 4-fluoro-2-methyl-N-[6-(2-methylpropylamino)-3-pyridinyl]benzenesulfonamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)Nc1ccc(NCC(C)C)nc1 |
| InChI | InChI=1S/C16H20FN3O2S/c1-11(2)9-18-16-7-5-14(10-19-16)20-23(21,22)15-6-4-13(17)8-12(15)3/h4-8,10-11,20H,9H2,1-3H3,(H,18,19) |
| InChIKey | JNTZQKOWAGRWEW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |