C20H25N3O3 — CID 113010088
N-[6-(cyclohexylamino)-3-pyridinyl]-2-(2-methoxyphenoxy)acetamide (PubChem CID 113010088) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[6-(cyclohexylamino)-3-pyridinyl]-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-[6-(cyclohexylamino)-3-pyridinyl]-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 113010088 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[6-(cyclohexylamino)-3-pyridinyl]-2-(2-methoxyphenoxy)acetamide |
| SMILES | COc1ccccc1OCC(=O)Nc1ccc(NC2CCCCC2)nc1 |
| InChI | InChI=1S/C20H25N3O3/c1-25-17-9-5-6-10-18(17)26-14-20(24)23-16-11-12-19(21-13-16)22-15-7-3-2-4-8-15/h5-6,9-13,15H,2-4,7-8,14H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | ZZYJWNKIUKCYOY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |