C15H23N3O2 — CID 113010320
N-[6-(2-methoxyethylamino)-3-pyridinyl]cyclohexanecarboxamide (PubChem CID 113010320) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is N-[6-(2-methoxyethylamino)-3-pyridinyl]cyclohexanecarboxamide.
| Compound Name | N-[6-(2-methoxyethylamino)-3-pyridinyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 113010320 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-[6-(2-methoxyethylamino)-3-pyridinyl]cyclohexanecarboxamide |
| SMILES | COCCNc1ccc(NC(=O)C2CCCCC2)cn1 |
| InChI | InChI=1S/C15H23N3O2/c1-20-10-9-16-14-8-7-13(11-17-14)18-15(19)12-5-3-2-4-6-12/h7-8,11-12H,2-6,9-10H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | ZNXRGJOELXILQL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|