C16H36OSi2 — CID 11301052
tert-butyl-dimethyl-[(Z)-4-triethylsilylbut-3-enoxy]silane (PubChem CID 11301052) has the molecular formula C16H36OSi2 and a molecular weight of 300.63 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z)-4-triethylsilylbut-3-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(Z)-4-triethylsilylbut-3-enoxy]silane |
|---|---|
| PubChem CID | 11301052 |
| Molecular Formula | C16H36OSi2 |
| Molecular Weight | 300.63 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | tert-butyl-dimethyl-[(Z)-4-triethylsilylbut-3-enoxy]silane |
| SMILES | CC[Si](/C=C\CCO[Si](C)(C)C(C)(C)C)(CC)CC |
| InChI | InChI=1S/C16H36OSi2/c1-9-19(10-2,11-3)15-13-12-14-17-18(7,8)16(4,5)6/h13,15H,9-12,14H2,1-8H3/b15-13- |
| InChIKey | PIMJHCHREGSTOF-SQFISAMPSA-N |
| XLogP | 6.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.63 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|