C14H23NO6 — CID 11301068
5-O-tert-butyl 4-O-methyl (3aR,4S,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4,5-dicarboxylate (PubChem CID 11301068) has the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. Its IUPAC name is 5-O-tert-butyl 4-O-methyl (3aR,4S,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 4-O-methyl (3aR,4S,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11301068 |
| Molecular Formula | C14H23NO6 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 5-O-tert-butyl 4-O-methyl (3aR,4S,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-4,5-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2OC(C)(C)O[C@H]2CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23NO6/c1-13(2,3)21-12(17)15-7-8-10(9(15)11(16)18-6)20-14(4,5)19-8/h8-10H,7H2,1-6H3/t8-,9-,10-/m0/s1 |
| InChIKey | USSBTCYUXUCDCC-GUBZILKMSA-N |
| XLogP | 1.30 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |