C17H17BrN4O2 — CID 113011122
2-bromo-N-[6-(4-formylpiperazin-1-yl)-3-pyridinyl]benzamide (PubChem CID 113011122) has the molecular formula C17H17BrN4O2 and a molecular weight of 389.25 g/mol. Its IUPAC name is 2-bromo-N-[6-(4-formylpiperazin-1-yl)-3-pyridinyl]benzamide.
| Compound Name | 2-bromo-N-[6-(4-formylpiperazin-1-yl)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 113011122 |
| Molecular Formula | C17H17BrN4O2 |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 2-bromo-N-[6-(4-formylpiperazin-1-yl)-3-pyridinyl]benzamide |
| SMILES | O=CN1CCN(c2ccc(NC(=O)c3ccccc3Br)cn2)CC1 |
| InChI | InChI=1S/C17H17BrN4O2/c18-15-4-2-1-3-14(15)17(24)20-13-5-6-16(19-11-13)22-9-7-21(12-23)8-10-22/h1-6,11-12H,7-10H2,(H,20,24) |
| InChIKey | MFWLVNSJEAPUFZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|