C19H26O3 — CID 11301115
(5S)-5-methoxy-5-[(2Z,5Z,8Z,11E)-tetradeca-2,5,8,11-tetraenyl]furan-2-one (PubChem CID 11301115) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (5S)-5-methoxy-5-[(2Z,5Z,8Z,11E)-tetradeca-2,5,8,11-tetraenyl]furan-2-one.
| Compound Name | (5S)-5-methoxy-5-[(2Z,5Z,8Z,11E)-tetradeca-2,5,8,11-tetraenyl]furan-2-one |
|---|---|
| PubChem CID | 11301115 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (5S)-5-methoxy-5-[(2Z,5Z,8Z,11E)-tetradeca-2,5,8,11-tetraenyl]furan-2-one |
| SMILES | CC/C=C/C/C=C\C/C=C\C/C=C\C[C@@]1(OC)C=CC(=O)O1 |
| InChI | InChI=1S/C19H26O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-16-19(21-2)17-15-18(20)22-19/h4-5,7-8,10-11,13-15,17H,3,6,9,12,16H2,1-2H3/b5-4+,8-7-,11-10-,14-13-/t19-/m0/s1 |
| InChIKey | BFLDYOKWEGYFDC-OQZVXLIISA-N |
| XLogP | 4.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|